Systematic / IUPAC Name: 5-[(E)-(4-Chlorobenzylidene)amino]-6-methyl-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one
ID: Reference4191
Other Names: 5-{[(4-Chlorophenyl)methylene]amino}-6-methyl-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one
Formula: C19H14ClN5O
5-{[(4-Chlorophenyl)methylene]amino}-6-methyl-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 11:18:46 AM |
| InChI | InChI=1S/C19H14ClN5O/c1-13-23-18-17(12-22-25(18)16-5-3-2-4-6-16)19(26)24(13)21-11-14-7-9-15(20)10-8-14/h2-12H,1H3/b21-11+ |
| InChI Key | DVSXSKUPAHZUFC-SRZZPIQSSA-N |
| Canonical SMILES | CC1=NC2=C(C=NN2C3=CC=CC=C3)C(=O)N1N=CC4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | 5-{[(4-Chlorophenyl)methylene]amino}-6-methyl-1-phenyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |