Systematic / IUPAC Name: (2E)-N-(4-Fluorophenyl)-3-(2-thienyl)acrylamide
ID: Reference4203
Other Names:
Formula: C13H10FNOS
N1-(4-Fluorophenyl)-3-(2-thienyl)acrylamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 2:29:36 PM |
| InChI | InChI=1S/C13H10FNOS/c14-10-3-5-11(6-4-10)15-13(16)8-7-12-2-1-9-17-12/h1-9H,(H,15,16)/b8-7+ |
| InChI Key | ZNPMMIABBKTXGN-BQYQJAHWSA-N |
| Canonical SMILES | C1=CSC(=C1)C=CC(=O)NC2=CC=C(C=C2)F |
| CAS | |
| Splash | |
| Other Names |