Systematic / IUPAC Name: 4-Methyl-3-[(2-nitrobenzyl)sulfanyl]-4H-1,2,4-triazole
ID: Reference4204
Other Names:
Formula: C10H10N4O2S
4-Methyl-3-[(2-nitrobenzyl)thio]-4H-1,2,4-triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 3:21:21 PM |
| InChI | InChI=1S/C10H10N4O2S/c1-13-7-11-12-10(13)17-6-8-4-2-3-5-9(8)14(15)16/h2-5,7H,6H2,1H3 |
| InChI Key | WBLWFZNICSSJMF-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 589416 |
| PubChem | 676728 |
| ChEMBL | CHEMBL1876067 |