Systematic / IUPAC Name: 2,2'-(1,3-Phenylene)bis(1H-benzimidazole-6-carboxylic acid)
ID: Reference4211
Other Names:
2-[3-(5-Carboxy-1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole-5-carboxylic acid;
1H-Benzimidazole-6-carboxylic acid, 2,2'-(1,3-phenylene)bis-
Formula: C22H14N4O4
2-[3-(5-Carboxy-1H-benzo[d]imidazol-2-yl)phenyl]-1H-benzo[d]imidazole-5-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 8:06:11 AM |
| InChI | InChI=1S/C22H14N4O4/c27-21(28)13-4-6-15-17(9-13)25-19(23-15)11-2-1-3-12(8-11)20-24-16-7-5-14(22(29)30)10-18(16)26-20/h1-10H,(H,23,25)(H,24,26)(H,27,28)(H,29,30) |
| InChI Key | TYWUMOFNWPUZTE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)C2=NC3=C(N2)C=C(C=C3)C(=O)O)C4=NC5=C(N4)C=C(C=C5)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-[3-(5-Carboxy-1H-benzimidazol-2-yl)phenyl]-1H-benzimidazole-5-carboxylic acid; 1H-Benzimidazole-6-carboxylic acid, 2,2'-(1,3-phenylene)bis- |