Systematic / IUPAC Name: 1-(2-Chlorophenyl)-3-(2-hydroxy-4,6-dimethylphenyl)-1,3-propanedione
ID: Reference4226
Other Names: 1-(2-Chlorophenyl)-3-(2-hydroxy-4,6-dimethyl-phenyl)propane-1,3-dione
Formula: C17H15ClO3
1-(2-Chlorophenyl)-3-(2-hydroxy-4,6-dimethylphenyl)-1,3-propanedione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 9:12:34 AM |
| InChI | InChI=1S/C17H15ClO3/c1-10-7-11(2)17(15(20)8-10)16(21)9-14(19)12-5-3-4-6-13(12)18/h3-8,20H,9H2,1-2H3 |
| InChI Key | PLDZLVPRRLTYPO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C(=C1)O)C(=O)CC(=O)C2=CC=CC=C2Cl)C |
| CAS | |
| Splash | |
| Other Names | 1-(2-Chlorophenyl)-3-(2-hydroxy-4,6-dimethyl-phenyl)propane-1,3-dione |
| ChemSpider | 2009377 |
| PubChem | 2727352 |
| ChEMBL | CHEMBL1364216 |