Systematic / IUPAC Name: Dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate
ID: Reference4229
Other Names:
2,5-Dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate;
Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate;
Methyl 3,4-dihydroxy-5-(methoxycarbonyl)pyrrole-2-carboxylate
Formula: C8H9NO6
Dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 9:21:47 AM |
| InChI | InChI=1S/C8H9NO6/c1-14-7(12)3-5(10)6(11)4(9-3)8(13)15-2/h9-11H,1-2H3 |
| InChI Key | QCPBGHYMHYWRHG-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=C(C(=C(N1)C(=O)OC)O)O |
| CAS | 1632195 |
| Splash | |
| Other Names |
2,5-Dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate; Dimethyl 3,4-dihydroxypyrrole-2,5-dicarboxylate; Methyl 3,4-dihydroxy-5-(methoxycarbonyl)pyrrole-2-carboxylate |