Systematic / IUPAC Name: 2-Cyclopropyl-1,5,7,8-tetrahydro-4H-thiopyrano[4,3-d]pyrimidin-4-one
ID: Reference4238
Other Names: 2-Cyclopropyl-7,8-dihydro-5H-thiino[4,3-d]pyrimidin-4-ol
Formula: C10H12N2OS
2-Cyclopropyl-7,8-dihydro-5H-thiino[4,3-d]pyrimidin-4-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 11:44:06 AM |
| InChI | InChI=1S/C10H12N2OS/c13-10-7-5-14-4-3-8(7)11-9(12-10)6-1-2-6/h6H,1-5H2,(H,11,12,13) |
| InChI Key | CLKYVIXIGHMFGP-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1C2=NC(=O)C3=C(N2)CCSC3 |
| CAS | |
| Splash | |
| Other Names | 2-Cyclopropyl-7,8-dihydro-5H-thiino[4,3-d]pyrimidin-4-ol |