Systematic / IUPAC Name: Methyl 3-(2,6-dichlorophenyl)-5-{[2-(methylcarbamoyl)hydrazino]carbonyl}-1,2-oxazole-4-carboxylate
ID: Reference4241
Other Names:
Formula: C14H12Cl2N4O5
Methyl 3-(2,6-dichlorophenyl)-5-({2-[(methylamino)carbonyl]hydrazino}carbonyl)isoxazole-4-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 11:50:06 AM |
| InChI | InChI=1S/C14H12Cl2N4O5/c1-17-14(23)19-18-12(21)11-9(13(22)24-2)10(20-25-11)8-6(15)4-3-5-7(8)16/h3-5H,1-2H3,(H,18,21)(H2,17,19,23) |
| InChI Key | WNNJWTIVQXGQCU-UHFFFAOYSA-N |
| Canonical SMILES | CNC(=O)NNC(=O)C1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 2008580 |
| ChEMBL | CHEMBL1870383 |
| PubChem | 2726518 |