Systematic / IUPAC Name: 3-(2-Hydroxy-5-methoxybenzoyl)-2-(4-methylphenyl)-1-isoindolinone
ID: Reference4242
Other Names: 3-(2-Hydroxy-5-methoxy-benzoyl)-2-(p-tolyl)isoindolin-1-one
Formula: C23H19NO4
3-(2-Hydroxy-5-methoxybenzoyl)-2-(4-methylphenyl)isoindolin-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 226 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 11:35:12 AM |
| InChI | InChI=1S/C23H19NO4/c1-14-7-9-15(10-8-14)24-21(17-5-3-4-6-18(17)23(24)27)22(26)19-13-16(28-2)11-12-20(19)25/h3-13,21,25H,1-2H3 |
| InChI Key | INLBTJWNEMKYDO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)N2C(C3=CC=CC=C3C2=O)C(=O)C4=C(C=CC(=C4)OC)O |
| CAS | |
| Splash | |
| Other Names | 3-(2-Hydroxy-5-methoxy-benzoyl)-2-(p-tolyl)isoindolin-1-one |
| PubChem | 2732547 |
| ChemSpider | 2014365 |
| ChEMBL | CHEMBL1536556 |