Systematic / IUPAC Name: 2,2'-{[(3,4,5-Trimethoxyphenyl)methylene]disulfanediyl}diacetic acid
ID: Reference4265
Other Names: Acetic acid, 2,2'-{[(3,4,5-trimethoxyphenyl)methylene]bis(thio)}bis-
Formula: C14H18O7S2
2-{[[(Carboxymethyl)thio](3,4,5-trimethoxyphenyl)methyl]thio}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 12:24:51 PM |
| InChI | InChI=1S/C14H18O7S2/c1-19-9-4-8(5-10(20-2)13(9)21-3)14(22-6-11(15)16)23-7-12(17)18/h4-5,14H,6-7H2,1-3H3,(H,15,16)(H,17,18) |
| InChI Key | JRTUBSRGQBERQQ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C(SCC(=O)O)SCC(=O)O |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2,2'-{[(3,4,5-trimethoxyphenyl)methylene]bis(thio)}bis- |