Systematic / IUPAC Name: (1Z)-1-{[4-(Diethylamino)phenyl]hydrazono}-2(1H)-naphthalenone
ID: Reference4267
Other Names:
Formula: C20H21N3O
1-{2-[4-(Diethylamino)phenyl]hydrazono}-1,2-dihydronaphthalen-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 1:23:20 PM |
| InChI | InChI=1S/C20H21N3O/c1-3-23(4-2)17-12-10-16(11-13-17)21-22-20-18-8-6-5-7-15(18)9-14-19(20)24/h5-14,21H,3-4H2,1-2H3/b22-20- |
| InChI Key | XRTFOOCIJLGYGH-XDOYNYLZSA-N |
| Canonical SMILES | CCN(CC)C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC=CC=C32 |
| CAS | |
| Splash | |
| Other Names |