Systematic / IUPAC Name: Diethyl {[2-(4-methoxybenzoyl)hydrazino]methylene}malonate
ID: Reference4270
Other Names: Propanedioic acid, 2-{[2-(4-methoxybenzoyl)hydrazinyl]methylene}-, diethyl ester
Formula: C16H20N2O6
Diethyl 2-{[2-(4-methoxybenzoyl)hydrazino]methylidene}malonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 2:15:11 PM |
| InChI | InChI=1S/C16H20N2O6/c1-4-23-15(20)13(16(21)24-5-2)10-17-18-14(19)11-6-8-12(22-3)9-7-11/h6-10,17H,4-5H2,1-3H3,(H,18,19) |
| InChI Key | QJSIMKAACUCJKF-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(=CNNC(=O)C1=CC=C(C=C1)OC)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names | Propanedioic acid, 2-{[2-(4-methoxybenzoyl)hydrazinyl]methylene}-, diethyl ester |