Systematic / IUPAC Name: 2-(3,4-Dimethoxyphenyl)-N-[2-(1-piperidinyl)phenyl]acetamide
ID: Reference4274
Other Names: Benzeneacetamide, 3,4-dimethoxy-N-[2-(1-piperidinyl)phenyl]-
Formula: C21H26N2O3
2-(3,4-Dimethoxyphenyl)-N-(2-piperidinophenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 275 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 6:44:42 AM |
| InChI | InChI=1S/C21H26N2O3/c1-25-19-11-10-16(14-20(19)26-2)15-21(24)22-17-8-4-5-9-18(17)23-12-6-3-7-13-23/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3,(H,22,24) |
| InChI Key | XJNQWJQBWFLYGJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)CC(=O)NC2=CC=CC=C2N3CCCCC3)OC |
| CAS | |
| Splash | |
| Other Names | Benzeneacetamide, 3,4-dimethoxy-N-[2-(1-piperidinyl)phenyl]- |
| PubChem | 2738553 |
| ChemSpider | 2020178 |
| ChEMBL | CHEMBL1726169 |