Systematic / IUPAC Name: 2-[(5-Acetyl-2-methoxybenzyl)sulfanyl]-4(3H)-pyrimidinone
ID: Reference4276
Other Names:
Formula: C14H14N2O3S
1-(3-{[(4-Hydroxypyrimidin-2-yl)thio]methyl}-4-methoxyphenyl)ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 8:55:39 AM |
| InChI | InChI=1S/C14H14N2O3S/c1-9(17)10-3-4-12(19-2)11(7-10)8-20-14-15-6-5-13(18)16-14/h3-7H,8H2,1-2H3,(H,15,16,18) |
| InChI Key | JQXANOKQUQWMJE-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C1=CC(=C(C=C1)OC)CSC2=NC=CC(=O)N2 |
| CAS | |
| Splash | |
| Other Names |