Systematic / IUPAC Name: 2-Butyne-1,4-diyl dibenzoate
ID: Reference4280
Other Names:
Formula: C18H14O4
4-(Benzoyloxy)but-2-ynyl benzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 9:24:24 AM |
| InChI | InChI=1S/C18H14O4/c19-17(15-9-3-1-4-10-15)21-13-7-8-14-22-18(20)16-11-5-2-6-12-16/h1-6,9-12H,13-14H2 |
| InChI Key | QFMWXECDLWDFTN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC#CCOC(=O)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |