Systematic / IUPAC Name: 2-[(4-Nitrobenzoyl)amino]-N-[3-(1-piperidinyl)propyl]benzamide
ID: Reference4282
Other Names:
Formula: C22H26N4O4
N1-(3-Piperidinopropyl)-2-[(4-nitrobenzoyl)amino]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 209 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 9:31:38 AM |
| InChI | InChI=1S/C22H26N4O4/c27-21(17-9-11-18(12-10-17)26(29)30)24-20-8-3-2-7-19(20)22(28)23-13-6-16-25-14-4-1-5-15-25/h2-3,7-12H,1,4-6,13-16H2,(H,23,28)(H,24,27) |
| InChI Key | NMYPVSNHRMVHNI-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |