Systematic / IUPAC Name: 2,2'-Carbonylbis[N-(2-methoxyphenyl)hydrazinecarbothioamide]
ID: Reference4290
Other Names: Carbonic dihydrazide, N'',N'''-bis{[(2-methoxyphenyl)amino]thioxomethyl}-
Formula: C17H20N6O3S2
N1-(2-Methoxyphenyl)-2-({2-[(2-methoxyanilino)carbothioyl]hydrazino}carbonyl)hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 12:38:56 PM |
| InChI | InChI=1S/C17H20N6O3S2/c1-25-13-9-5-3-7-11(13)18-16(27)22-20-15(24)21-23-17(28)19-12-8-4-6-10-14(12)26-2/h3-10H,1-2H3,(H2,18,22,27)(H2,19,23,28)(H2,20,21,24) |
| InChI Key | HLGUJBSVELTFAV-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC=C1NC(=S)NNC(=O)NNC(=S)NC2=CC=CC=C2OC |
| CAS | |
| Splash | |
| Other Names | Carbonic dihydrazide, N'',N'''-bis{[(2-methoxyphenyl)amino]thioxomethyl}- |