Systematic / IUPAC Name: (2-Acetamido-3-pyridyl) acetate
ID: Reference4294
Other Names: Acetamide, N-[3-(acetyloxy)-2-pyridinyl]-
Formula: C9H10N2O3
2-(Acetylamino)-3-pyridyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 1:57:27 PM |
| InChI | InChI=1S/C9H10N2O3/c1-6(12)11-9-8(14-7(2)13)4-3-5-10-9/h3-5H,1-2H3,(H,10,11,12) |
| InChI Key | IDZIZSUOFZCQBI-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=C(C=CC=N1)OC(=O)C |
| CAS | 26372532 |
| Splash | |
| Other Names | Acetamide, N-[3-(acetyloxy)-2-pyridinyl]- |