Systematic / IUPAC Name: 5-(Methylsulfanyl)-2-thiophenecarboxamide
ID: Reference4302
Other Names: 2-Thiophenecarboxamide, 5-(methylthio)-
Formula: C6H7NOS2
5-(Methylthio)thiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 9:51:56 AM |
| InChI | InChI=1S/C6H7NOS2/c1-9-5-3-2-4(10-5)6(7)8/h2-3H,1H3,(H2,7,8) |
| InChI Key | WJLPSVYJZOPSNY-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=C(S1)C(=O)N |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxamide, 5-(methylthio)- |