Systematic / IUPAC Name: 4-Chloro-N-{2-[(4-chlorobenzyl)sulfanyl]ethyl}benzamide
ID: Reference4327
Other Names: Benzamide, 4-chloro-N-(2-{[(4-chlorophenyl)methyl]thio}ethyl)-
Formula: C16H15Cl2NOS
4-Chloro-N-{2-[(4-chlorobenzyl)thio]ethyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 7:05:42 AM |
| InChI | InChI=1S/C16H15Cl2NOS/c17-14-5-1-12(2-6-14)11-21-10-9-19-16(20)13-3-7-15(18)8-4-13/h1-8H,9-11H2,(H,19,20) |
| InChI Key | CURIYHGUJUPDSQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CSCCNC(=O)C2=CC=C(C=C2)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Benzamide, 4-chloro-N-(2-{[(4-chlorophenyl)methyl]thio}ethyl)- |