Systematic / IUPAC Name: 1,3-Benzothiazole-6-carboxylic acid
ID: Reference4329
Other Names:
6-Benzothiazolecarboxylic acid;
6-Carboxy-1,3-benzothiazole;
Benzo[d]thiazole-6-carboxylic acid;
Benzothiazole-6-carboxylic acid
Formula: C8H5NO2S
1,3-Benzothiazole-6-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 9:19:48 AM |
| InChI | InChI=1S/C8H5NO2S/c10-8(11)5-1-2-6-7(3-5)12-4-9-6/h1-4H,(H,10,11) |
| InChI Key | DMPZJACLHDWUFS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=C1C(=O)O)SC=N2 |
| CAS | 3622353 |
| Splash | |
| Other Names |
6-Benzothiazolecarboxylic acid; 6-Carboxy-1,3-benzothiazole; Benzo[d]thiazole-6-carboxylic acid; Benzothiazole-6-carboxylic acid |
| PubChem | 601670 |
| ChEMBL | CHEMBL1579917 |
| ChemSpider | 523045 |