Systematic / IUPAC Name: 6-Phenoxynicotinic acid
ID: Reference4333
Other Names: 6-Phenoxypyridine-3-carboxylic acid
Formula: C12H9NO3
6-Phenoxynicotinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 9:33:51 AM |
| InChI | InChI=1S/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
| InChI Key | GFEUNYLQJDQNAN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=NC=C(C=C2)C(=O)O |
| CAS | |
| Splash | |
| Other Names | 6-Phenoxypyridine-3-carboxylic acid |