Systematic / IUPAC Name: 4-{2-[(2-Chlorophenoxy)methyl]-4-methyl-1,3-thiazol-5-yl}-2-pyrimidinamine
ID: Reference4343
Other Names:
Kinome 3424 ;
2-Pyrimidinamine, 4-{2-[(2-chlorophenoxy)methyl]-4-methyl-5-thiazolyl}-
Formula: C15H13ClN4OS
4-{2-[(2-Chlorophenoxy)methyl]-4-methyl-1,3-thiazol-5-yl}pyrimidin-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 2:57:20 PM |
| InChI | InChI=1S/C15H13ClN4OS/c1-9-14(11-6-7-18-15(17)20-11)22-13(19-9)8-21-12-5-3-2-4-10(12)16/h2-7H,8H2,1H3,(H2,17,18,20) |
| InChI Key | SVUIYNKSDCANAY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=N1)COC2=CC=CC=C2Cl)C3=NC(=NC=C3)N |
| CAS | |
| Splash | |
| Other Names |
Kinome 3424 ; 2-Pyrimidinamine, 4-{2-[(2-chlorophenoxy)methyl]-4-methyl-5-thiazolyl}- |
| ChemSpider | 2025772 |
| PubChem | 2744272 |
| ChEMBL | CHEMBL1375640 |