Systematic / IUPAC Name: 4-{5-[4-(Trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl}pyridine
ID: Reference4347
Other Names: Pyridine, 4-{5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl}-
Formula: C14H8F3N3O2
2-(4-Pyridyl)-5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/23/2016 8:04:11 AM |
| InChI | InChI=1S/C14H8F3N3O2/c15-14(16,17)22-11-3-1-9(2-4-11)12-19-20-13(21-12)10-5-7-18-8-6-10/h1-8H |
| InChI Key | FCNYJGLDJPQOTF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=NC=C3)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Pyridine, 4-{5-[4-(trifluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl}- |