Systematic / IUPAC Name: 2-[(2E)-2-(2-Chlorobenzylidene)hydrazino]-4-(trifluoromethyl)-1,3-thiazole
ID: Reference4350
Other Names:
Formula: C11H7ClF3N3S
2-Chlorobenzaldehyde 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]hydrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 228 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/23/2016 11:37:04 AM |
| InChI | InChI=1S/C11H7ClF3N3S/c12-8-4-2-1-3-7(8)5-16-18-10-17-9(6-19-10)11(13,14)15/h1-6H,(H,17,18)/b16-5+ |
| InChI Key | ZWXHVYWKWUTFSU-FZSIALSZSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C=NNC2=NC(=CS2)C(F)(F)F)Cl |
| CAS | |
| Splash | |
| Other Names |