Systematic / IUPAC Name: 2-Amino-3,7-dihydropurin-6-one
ID: Reference436
Other Names:
2-Amino-6-hydroxypurine;
2-Aminohypoxanthine;
6-Hydroxy-2-aminopurine;
6H-Purin-6-one, 2-amino-1,7-dihydro-;
Hypoxanthine, 2-amino-
; more
Formula: C5H5N5O
Class: Endogenous Metabolites
Guanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 1079 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/20/2015 9:55:57 AM |
| InChI | InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) |
| InChI Key | UYTPUPDQBNUYGX-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 73405 |
| Splash | |
| Other Names |
2-Amino-6-hydroxypurine; 2-Aminohypoxanthine; 6-Hydroxy-2-aminopurine; 6H-Purin-6-one, 2-amino-1,7-dihydro-; Hypoxanthine, 2-amino-; 2-Amino-1H-purin-6(7H)-one; 2-Amino-1,7-dihydro-6H-purin-6-one; 2-Amino-9H-purin-6-ol; 2-Amino-6-oxopurine; 2-Amino-1,9-dihydro-6H-purin-6-one; 6H-Purin-6-one, 2-amino-1,9-dihydro-; 2-Amino-6-hydroxy-1H-purine; 2-Amino-3H-purin-6(7H)-one; 2-Aminohydropurin-6-one; Guanin |
| ChEBI | CHEBI:16235 |
| Wikipedia | Guanine |
| ChEMBL | CHEMBL219568 |
| ChemIDPlus | 000073405; 010333923; 073806652 |
| ChemSpider | 744 |
| KEGG | C00242 |
| PubChem | 764 |
| HMDb | HMDB00132 |