Systematic / IUPAC Name: 3-[3,5-Dimethyl-2-(phenylcarbamoyl)phenyl]-2,2-dimethylpropanoic acid
ID: Reference4373
Other Names: Benzenepropanoic acid, α,α,3,5-tetramethyl-2-[(phenylamino)carbonyl]-
Formula: C20H23NO3
3-[2-(Anilinocarbonyl)-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 6:49:51 AM |
| InChI | InChI=1S/C20H23NO3/c1-13-10-14(2)17(15(11-13)12-20(3,4)19(23)24)18(22)21-16-8-6-5-7-9-16/h5-11H,12H2,1-4H3,(H,21,22)(H,23,24) |
| InChI Key | YCJSLNUSGGTXOE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C(=C1)CC(C)(C)C(=O)O)C(=O)NC2=CC=CC=C2)C |
| CAS | |
| Splash | |
| Other Names | Benzenepropanoic acid, α,α,3,5-tetramethyl-2-[(phenylamino)carbonyl]- |
| PubChem | 2803729 |
| ChemSpider | 2082347 |
| ChEMBL | CHEMBL1562206 |