Systematic / IUPAC Name: Ethyl 5-{[(4-chlorophenyl)sulfonyl]amino}-1-methyl-1H-pyrazole-4-carboxylate
ID: Reference4374
Other Names:
Formula: C13H14ClN3O4S
Ethyl 5-{[(4-chlorophenyl)sulfonyl]amino}-1-methyl-1H-pyrazole-4-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 7:02:10 AM |
| InChI | InChI=1S/C13H14ClN3O4S/c1-3-21-13(18)11-8-15-17(2)12(11)16-22(19,20)10-6-4-9(14)5-7-10/h4-8,16H,3H2,1-2H3 |
| InChI Key | NVLNVCYTMMSSDO-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(N(N=C1)C)NS(=O)(=O)C2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names |