Systematic / IUPAC Name: N-(1-Methyl-1H-pyrazol-5-yl)-3-phenylpropanamide
ID: Reference4377
Other Names: Benzenepropanamide, N-(1-methyl-1H-pyrazol-5-yl)-
Formula: C13H15N3O
N-(1-Methyl-1H-pyrazol-5-yl)-3-phenylpropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 8:51:13 AM |
| InChI | InChI=1S/C13H15N3O/c1-16-12(9-10-14-16)15-13(17)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,15,17) |
| InChI Key | RDRCUEVWULSLKN-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CC=N1)NC(=O)CCC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | Benzenepropanamide, N-(1-methyl-1H-pyrazol-5-yl)- |