Systematic / IUPAC Name: 5-(4-Morpholinylsulfonyl)-N-(4-sulfamoylphenyl)-2-furamide
ID: Reference4386
Other Names:
Formula: C15H17N3O7S2
Class: Endogenous Metabolites
N-[4-(Aminosulfonyl)phenyl]-5-(morpholinosulfonyl)-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2427 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 4/19/2016 1:57:49 PM |
| InChI | InChI=1S/C15H17N3O7S2/c16-26(20,21)12-3-1-11(2-4-12)17-15(19)13-5-6-14(25-13)27(22,23)18-7-9-24-10-8-18/h1-6H,7-10H2,(H,17,19)(H2,16,20,21) |
| InChI Key | YOYGWXGTVRXFPO-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1S(=O)(=O)C2=CC=C(O2)C(=O)NC3=CC=C(C=C3)S(=O)(=O)N |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 2809649 |
| ChemSpider | 2088071 |
| ChEMBL | CHEMBL2135100 |