Systematic / IUPAC Name: 2-Chloro-N-(2-phenoxyphenyl)benzamide
ID: Reference4388
Other Names: N1-(2-Phenoxyphenyl)-2-chlorobenzamide
Formula: C19H14ClNO2
2-Chloro-N-(2-phenoxyphenyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/31/2016 8:41:51 AM |
| InChI | InChI=1S/C19H14ClNO2/c20-16-11-5-4-10-15(16)19(22)21-17-12-6-7-13-18(17)23-14-8-2-1-3-9-14/h1-13H,(H,21,22) |
| InChI Key | WBTZCQPDWMPMTD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2NC(=O)C3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names | N1-(2-Phenoxyphenyl)-2-chlorobenzamide |