Systematic / IUPAC Name: 3-Hydroxy-2-nitro-1H-phenalen-1-one
ID: Reference4399
Other Names:
Formula: C13H7NO4
3-Hydroxy-2-nitro-1H-phenalen-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 61 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/1/2016 6:40:42 AM |
| InChI | InChI=1S/C13H7NO4/c15-12-8-5-1-3-7-4-2-6-9(10(7)8)13(16)11(12)14(17)18/h1-6,15H |
| InChI Key | AOKXKECEFQAIAD-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 2064726 |
| PubChem | 2784799 |
| ChEMBL | CHEMBL1462267 |