Systematic / IUPAC Name: 4-[(1R,6R)-6-Isopropenyl-3-methyl-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol
ID: Reference4435
Other Names:
Abn-CBD ;
Abnormal cannabidiol;
Cannabidiol, abnormal;
4-[(1R,6R)-3-Methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol;
4-[(1R,6R)-3-Methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol
Formula: C21H30O2
Class: Therapeutics/Prescription Drugs
CAY10429 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3356 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 4/6/2016 1:58:01 PM |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-16-12-17(22)13-20(23)21(16)19-11-15(4)9-10-18(19)14(2)3/h11-13,18-19,22-23H,2,5-10H2,1,3-4H3/t18-,19+/m0/s1 |
| InChI Key | YWEZXUNAYVCODW-RBUKOAKNSA-N |
| Canonical SMILES | CCCCCC1=CC(=CC(=C1C2C=C(CCC2C(=C)C)C)O)O |
| CAS | 22972550 |
| Splash | |
| Other Names |
Abn-CBD ; Abnormal cannabidiol; Cannabidiol, abnormal; 4-[(1R,6R)-3-Methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol; 4-[(1R,6R)-3-Methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol; 4-[(1R,6R)-3-Methyl-6-prop-1-en-2-yl-1-cyclohex-2-enyl]-5-pentylbenzene-1,3-diol |
| ChemSpider | 81197 |
| ChemIDPlus | 022972550 |
| PubChem | 89949 |
| Wikipedia | Abnormal cannabidiol |