Systematic / IUPAC Name: 2-(1H-Indol-3-yl)acetic acid
ID: Reference445
Other Names:
(1H-Indol-3-yl)-acetate;
(Indol-3-yl)acetate;
1H-Indole-3-acetate;
2-(1H-Indol-3-yl)acetate;
2-(3-Indolyl)acetate
; more
Formula: C10H9NO2
Class: Endogenous Metabolites Natural Products/Medicines
Indole-3-acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 810 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 1/20/2017 10:01:41 AM |
| InChI | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13) |
| InChI Key | SEOVTRFCIGRIMH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)O |
| CAS | 87514 |
| Splash | |
| Other Names |
(1H-Indol-3-yl)-acetate; (Indol-3-yl)acetate; 1H-Indole-3-acetate; 2-(1H-Indol-3-yl)acetate; 2-(3-Indolyl)acetate; 2-(Indol-3-yl)ethanoic acid; 3-Indolylacetate; Indol-3-ylacetate; Rhizopin; Rhizopon A; α-Indol-3-yl-acetic acid; β-Indole-3-acetic acid; β-Indoleacetic acid; β-Indolylacetic acid; (1H-Indol-3-yl)acetic acid; (Indol-3-yl)acetic acid; 1H-Indol-3-ylacetic acid; 1H-Indole-3-acetic acid; 2-(3-Indolyl)acetic acid; 2-Indol-3-ylacetic acid; 3-Indoleacetic acid; 3-Indolylacetic acid; 3-Indolylmethylcarboxylic acid; Indol-3-acetic acid; Indol-3-ylacetic acid; Indole-3-acetic acid; Indoleacetic acid; IAA ; Heteroauxin |
| HMDb | HMDB00197 |
| Wikipedia | Indole-3-acetic acid |
| PubChem | 802 |
| ChemSpider | 780 |
| ChemIDPlus | 000087514; 002338194; 084434877 |
| ChEBI | CHEBI:16411 |
| ChEMBL | CHEMBL82411 |
| KEGG | C00954 |