Systematic / IUPAC Name: N-[(5-Chloro-1-benzothiophen-3-yl)methyl]-2-(4-chlorophenoxy)nicotinamide
ID: Reference4454
Other Names: 3-Pyridinecarboxamide, N-[(5-chlorobenzo[b]thien-3-yl)methyl]-2-(4-chlorophenoxy)-
Formula: C21H14Cl2N2O2S
N-[(5-Chloro-1-benzothiophen-3-yl)methyl]-2-(4-chlorophenoxy)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/7/2016 12:49:21 PM |
| InChI | InChI=1S/C21H14Cl2N2O2S/c22-14-3-6-16(7-4-14)27-21-17(2-1-9-24-21)20(26)25-11-13-12-28-19-8-5-15(23)10-18(13)19/h1-10,12H,11H2,(H,25,26) |
| InChI Key | QYHBXEIVDFWXED-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)Cl)C(=O)NCC3=CSC4=C3C=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, N-[(5-chlorobenzo[b]thien-3-yl)methyl]-2-(4-chlorophenoxy)- |