Systematic / IUPAC Name: 1-Phenyl-2-{[4-(2-thienyl)-2-pyrimidinyl]sulfanyl}ethanone
ID: Reference4468
Other Names: Ethanone, 1-phenyl-2-{[4-(2-thienyl)-2-pyrimidinyl]thio}-
Formula: C16H12N2OS2
1-Phenyl-2-{[4-(2-thienyl)-2-pyrimidinyl]sulfanyl}-1-ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/8/2016 9:51:48 AM |
| InChI | InChI=1S/C16H12N2OS2/c19-14(12-5-2-1-3-6-12)11-21-16-17-9-8-13(18-16)15-7-4-10-20-15/h1-10H,11H2 |
| InChI Key | RQHBSNMLAGLHHN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)CSC2=NC=CC(=N2)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1-phenyl-2-{[4-(2-thienyl)-2-pyrimidinyl]thio}- |