Systematic / IUPAC Name: (E)-1-(1,3-Benzodioxol-4-yl)-N-{[5-(2-naphthyl)-1,3,4-oxadiazol-2-yl]methoxy}methanimine
ID: Reference4486
Other Names:
Formula: C21H15N3O4
1,3-Benzodioxole-4-carbaldehyde O-{[5-(2-naphthyl)-1,3,4-oxadiazol-2-yl]methyl}oxime mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 7:13:36 AM |
| InChI | InChI=1S/C21H15N3O4/c1-2-5-15-10-16(9-8-14(15)4-1)21-24-23-19(28-21)12-27-22-11-17-6-3-7-18-20(17)26-13-25-18/h1-11H,12-13H2/b22-11+ |
| InChI Key | OZHYRDCLPSPGOM-SSDVNMTOSA-N |
| Canonical SMILES | C1OC2=CC=CC(=C2O1)C=NOCC3=NN=C(O3)C4=CC5=CC=CC=C5C=C4 |
| CAS | |
| Splash | |
| Other Names |