Systematic / IUPAC Name: (E)-3-(1H-Indol-3-yl)prop-2-enoic acid
ID: Reference449
Other Names:
3-Indoleacrylic acid;
3-Indolylacrylic acid;
3-(3-Indolyl)acrylic acid;
Indole-3β-acrylic acid;
3-(Indol-3-yl)acrylic acid
; more
Formula: C11H9NO2
Class: Endogenous Metabolites
Indole-3-acrylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 304 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/21/2015 11:18:56 AM |
| InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-7,12H,(H,13,14)/b6-5+ |
| InChI Key | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C/C(=O)O |
| CAS | 1204064 |
| Splash | |
| Other Names |
3-Indoleacrylic acid; 3-Indolylacrylic acid; 3-(3-Indolyl)acrylic acid; Indole-3β-acrylic acid; 3-(Indol-3-yl)acrylic acid; Indole-3-acrylic acid; (2E)-3-(1H-Indol-3-yl)acrylic acid; 3-(1H-Indol-3-yl)acrylic acid; trans-3-(1H-Indol-3-yl)acrylic acid; 2-Propenoic acid, 3-(1H-indol-3-yl)-; 3-(1H-Indol-3-yl)-2-propenoic acid; (2E)-3-(1H-Indol-3-yl)prop-2-enoic acid; (2E)-3-Indol-3-ylprop-2-enoic acid; 3-(1H-Indol-3-yl)prop-2-enoic acid; trans-3-(1H-Indol-3-yl)prop-2-enoic acid; (2E)-3-(1H-Indol-3-yl)-2-propenoic acid; 2-Propenoic acid, 3-(1H-indol-3-yl)-, (2E)- |
| ChemIDPlus | 001204064 |
| ChemSpider | 4524636 |
| PubChem | 5375048 |
| ChEMBL | CHEMBL445966 |