Systematic / IUPAC Name: N-Benzyl-N-isopropyl-4-methyl-1,2,3-thiadiazole-5-carboxamide
ID: Reference4492
Other Names:
N-Benzyl-4-methyl-N-(propan-2-yl)-1,2,3-thiadiazole-5-carboxamide;
1,2,3-Thiadiazole-5-carboxamide, 4-methyl-N-(1-methylethyl)-N-(phenylmethyl)-
Formula: C14H17N3OS
N-Benzyl-N-isopropyl-4-methyl-1,2,3-thiadiazole-5-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 8:15:05 AM |
| InChI | InChI=1S/C14H17N3OS/c1-10(2)17(9-12-7-5-4-6-8-12)14(18)13-11(3)15-16-19-13/h4-8,10H,9H2,1-3H3 |
| InChI Key | ZENNPRLFFLOUAU-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SN=N1)C(=O)N(CC2=CC=CC=C2)C(C)C |
| CAS | |
| Splash | |
| Other Names |
N-Benzyl-4-methyl-N-(propan-2-yl)-1,2,3-thiadiazole-5-carboxamide; 1,2,3-Thiadiazole-5-carboxamide, 4-methyl-N-(1-methylethyl)-N-(phenylmethyl)- |
| PubChem | 2813487 |
| ChEMBL | CHEMBL1607204 |
| ChemSpider | 2091888 |