Systematic / IUPAC Name: Ethyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate
ID: Reference4495
Other Names:
2,7-Dimethyl-imidazo[1,2-a]pyridine-3-carboxylic acid ethyl ester;
Ethyl 2,7-dimethyl-4-hydroimidazo[1,2-a]pyridine-3-carboxylate;
Imidazo[1,2-a]pyridine-3-carboxylic acid, 2,7-dimethyl-, ethyl ester
Formula: C12H14N2O2
Ethyl 2,7-dimethylimidazo[1,2-a]pyridine-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 9:19:48 AM |
| InChI | InChI=1S/C12H14N2O2/c1-4-16-12(15)11-9(3)13-10-7-8(2)5-6-14(10)11/h5-7H,4H2,1-3H3 |
| InChI Key | CQNUHMHESISBRX-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(N=C2N1C=CC(=C2)C)C |
| CAS | 81448488 |
| Splash | |
| Other Names |
2,7-Dimethyl-imidazo[1,2-a]pyridine-3-carboxylic acid ethyl ester; Ethyl 2,7-dimethyl-4-hydroimidazo[1,2-a]pyridine-3-carboxylate; Imidazo[1,2-a]pyridine-3-carboxylic acid, 2,7-dimethyl-, ethyl ester |
| ChEMBL | CHEMBL1300398 |
| PubChem | 682232 |
| ChemSpider | 594297 |