Systematic / IUPAC Name: 2-Hydroxy-3-(1H-indol-3-yl)propanoic acid
ID: Reference450
Other Names:
α-Hydroxy-1H-indole-3-propanoic acid;
3-(3-Indolyl)-2-hydroxypropanoic acid;
α-Hydroxy-1H-indole-3-propionic acid;
2-Hydroxy-3-indol-3-yl-propionate;
2-Hydroxy-3-indol-3-yl-propionic acid
; more
Formula: C11H11NO3
Class: Endogenous Metabolites
Indole-3-lactic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 291 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/21/2015 1:43:33 PM |
| InChI | InChI=1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15) |
| InChI Key | XGILAAMKEQUXLS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)O |
| CAS | 1821529 |
| Splash | |
| Other Names |
α-Hydroxy-1H-indole-3-propanoic acid; 3-(3-Indolyl)-2-hydroxypropanoic acid; α-Hydroxy-1H-indole-3-propionic acid; 2-Hydroxy-3-indol-3-yl-propionate; 2-Hydroxy-3-indol-3-yl-propionic acid; (+)-2-Hydroxy-3-indol-3-yl-propionic acid; (+)-α-Hydroxy-1H-indole-3-propanoic acid; (+)-α-Hydroxy-1H-indole-3-propionic acid; 1H-Indole-3-propanoic acid, α-hydroxy-; Indole-3-lactic acid; Indolelactate; Indolelactic acid; 3-(Indol-3-yl)lactic acid |
| ChemIDPlus | 001821529; 000832973 |
| ChEMBL | CHEMBL485011 |
| PubChem | 92904 |
| KEGG | C02043 |
| ChEBI | CHEBI:24813 |
| ChemSpider | 83867 |
| HMDb | HMDB00671 |