Systematic / IUPAC Name: N-(2-Acetamido-5-methoxyphenyl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide
ID: Reference4509
Other Names:
Formula: C20H18ClN3O4
N4-[2-(Acetylamino)-5-methoxyphenyl]-3-(2-chlorophenyl)-5-methylisoxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 222 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 2:17:07 PM |
| InChI | InChI=1S/C20H18ClN3O4/c1-11-18(19(24-28-11)14-6-4-5-7-15(14)21)20(26)23-17-10-13(27-3)8-9-16(17)22-12(2)25/h4-10H,1-3H3,(H,22,25)(H,23,26) |
| InChI Key | DHJVGCLUURTIGR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NC3=C(C=CC(=C3)OC)NC(=O)C |
| CAS | |
| Splash | |
| Other Names |