Systematic / IUPAC Name: 2-[(2E)-2-(3,4,5-Trimethoxybenzylidene)hydrazino]-1,3-thiazol-4(5H)-one
ID: Reference4510
Other Names: 2-[(2E)-2-(3,4,5-Trimethoxybenzylidene)hydrazinyl]-1,3-thiazol-4(5H)-one
Formula: C13H15N3O4S
2-[2-(3,4,5-Trimethoxybenzylidene)hydrazono]-1,3-thiazolan-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/12/2016 7:27:40 AM |
| InChI | InChI=1S/C13H15N3O4S/c1-18-9-4-8(5-10(19-2)12(9)20-3)6-14-16-13-15-11(17)7-21-13/h4-6H,7H2,1-3H3,(H,15,16,17)/b14-6+ |
| InChI Key | FTTJVOUPARAIBB-MKMNVTDBSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C=NNC2=NC(=O)CS2 |
| CAS | |
| Splash | |
| Other Names | 2-[(2E)-2-(3,4,5-Trimethoxybenzylidene)hydrazinyl]-1,3-thiazol-4(5H)-one |