Systematic / IUPAC Name: 3,3'-(1H-Benzimidazole-1,2-diyl)dipropanoic acid
ID: Reference4539
Other Names:
Formula: C13H14N2O4
3-[1-(2-Carboxyethyl)-1H-benzo[d]imidazol-2-yl]propanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/13/2016 1:06:10 PM |
| InChI | InChI=1S/C13H14N2O4/c16-12(17)6-5-11-14-9-3-1-2-4-10(9)15(11)8-7-13(18)19/h1-4H,5-8H2,(H,16,17)(H,18,19) |
| InChI Key | HIYOVKINRUARBW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=C(N2CCC(=O)O)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names |