Systematic / IUPAC Name: (2E)-3-(1-Benzofuran-2-yl)-2-(2-pyridinylsulfonyl)acrylonitrile
ID: Reference4547
Other Names:
Formula: C16H10N2O3S
3-Benzo[b]furan-2-yl-2-(2-pyridylsulfonyl)acrylonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 120 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/14/2016 7:18:01 AM |
| InChI | InChI=1S/C16H10N2O3S/c17-11-14(22(19,20)16-7-3-4-8-18-16)10-13-9-12-5-1-2-6-15(12)21-13/h1-10H/b14-10+ |
| InChI Key | BAFOSINEXFQCIY-GXDHUFHOSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=C(O2)C=C(C#N)S(=O)(=O)C3=CC=CC=N3 |
| CAS | |
| Splash | |
| Other Names |