Systematic / IUPAC Name: N-[2-(3,4-Dimethoxyphenyl)ethyl]-4,5-dihydro-1,3-thiazol-2-amine
ID: Reference4555
Other Names: (2Z)-N-[2-(3,4-Dimethoxyphenyl)ethyl]-1,3-thiazolidin-2-imine
Formula: C13H18N2O2S
N1-(1,3-Thiazolan-2-yliden)-2-(3,4-dimethoxyphenyl)ethan-1-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/14/2016 9:42:06 AM |
| InChI | InChI=1S/C13H18N2O2S/c1-16-11-4-3-10(9-12(11)17-2)5-6-14-13-15-7-8-18-13/h3-4,9H,5-8H2,1-2H3,(H,14,15) |
| InChI Key | GCTMZOOVTKJPJX-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)CCNC2=NCCS2)OC |
| CAS | |
| Splash | |
| Other Names | (2Z)-N-[2-(3,4-Dimethoxyphenyl)ethyl]-1,3-thiazolidin-2-imine |
| PubChem | 2731061 |
| ChEMBL | CHEMBL1533020 |
| ChemSpider | 2012970 |