Systematic / IUPAC Name: Ethyl 5-({[5-(methylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl}methyl)-1,2-oxazole-3-carboxylate
ID: Reference4557
Other Names: 3-Isoxazolecarboxylic acid, 5-({[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}methyl)-, ethyl ester
Formula: C10H11N3O3S3
Ethyl 5-({[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}methyl)isoxazole-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/14/2016 11:13:12 AM |
| InChI | InChI=1S/C10H11N3O3S3/c1-3-15-8(14)7-4-6(16-13-7)5-18-10-12-11-9(17-2)19-10/h4H,3,5H2,1-2H3 |
| InChI Key | WMSYFVFZQPSZHD-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=NOC(=C1)CSC2=NN=C(S2)SC |
| CAS | |
| Splash | |
| Other Names | 3-Isoxazolecarboxylic acid, 5-({[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}methyl)-, ethyl ester |