Systematic / IUPAC Name: 3-[3,5-Bis(trifluoromethyl)phenyl]-1-(2-cyanoethyl)-1-(tetrahydro-2-furanylmethyl)thiourea
ID: Reference4581
Other Names: Thiourea, N'-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-N-[(tetrahydro-2-furanyl)methyl]-
Formula: C17H17F6N3OS
N-(2-Cyanoethyl)-N'-[3,5-bis(trifluoromethyl)phenyl]-N-tetrahydrofuran-2-ylmethylthiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/18/2016 8:59:46 AM |
| InChI | InChI=1S/C17H17F6N3OS/c18-16(19,20)11-7-12(17(21,22)23)9-13(8-11)25-15(28)26(5-2-4-24)10-14-3-1-6-27-14/h7-9,14H,1-3,5-6,10H2,(H,25,28) |
| InChI Key | IOYMNCOARVSXDS-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(OC1)CN(CCC#N)C(=S)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Thiourea, N'-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-N-[(tetrahydro-2-furanyl)methyl]- |