Systematic / IUPAC Name: 6,7,8-Triphenyl[1,2,4]triazolo[4,3-b]pyridazin-3(2H)-one
ID: Reference4591
Other Names: 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6,7,8-triphenyl-
Formula: C23H16N4O
6,7,8-Triphenyl-2,3-dihydro[1,2,4]triazolo[4,3-b]pyridazin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 176 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/18/2016 12:46:29 PM |
| InChI | InChI=1S/C23H16N4O/c28-23-25-24-22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(26-27(22)23)18-14-8-3-9-15-18/h1-15H,(H,25,28) |
| InChI Key | NIAWRJJDBZPOSG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C3=NNC(=O)N3N=C2C4=CC=CC=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | 1,2,4-Triazolo[4,3-b]pyridazin-3(2H)-one, 6,7,8-triphenyl- |