Systematic / IUPAC Name: 4-[(4-Methylphenyl)sulfanyl]thieno[3,2-d]pyrimidine
ID: Reference4615
Other Names: Thieno[3,2-d]pyrimidine, 4-[(4-methylphenyl)thio]-
Formula: C13H10N2S2
4-[(4-Methylphenyl)thio]thieno[3,2-d]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 8:01:51 AM |
| InChI | InChI=1S/C13H10N2S2/c1-9-2-4-10(5-3-9)17-13-12-11(6-7-16-12)14-8-15-13/h2-8H,1H3 |
| InChI Key | NJDAUYMIPXZBPV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)SC2=NC=NC3=C2SC=C3 |
| CAS | |
| Splash | |
| Other Names | Thieno[3,2-d]pyrimidine, 4-[(4-methylphenyl)thio]- |